C19H18N2O3S — CID 123706103
7-[(2,4-dimethylphenyl)diazenyl]-5-methylnaphthalene-1-sulfonic acid (PubChem CID 123706103) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is 7-[(2,4-dimethylphenyl)diazenyl]-5-methylnaphthalene-1-sulfonic acid.
| Compound Name | 7-[(2,4-dimethylphenyl)diazenyl]-5-methylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 123706103 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 7-[(2,4-dimethylphenyl)diazenyl]-5-methylnaphthalene-1-sulfonic acid |
| SMILES | Cc1ccc(/N=N/c2cc(C)c3cccc(S(=O)(=O)O)c3c2)c(C)c1 |
| InChI | InChI=1S/C19H18N2O3S/c1-12-7-8-18(14(3)9-12)21-20-15-10-13(2)16-5-4-6-19(17(16)11-15)25(22,23)24/h4-11H,1-3H3,(H,22,23,24)/b21-20+ |
| InChIKey | CHZOSKXJIFAFFC-QZQOTICOSA-N |
| XLogP | 5.43 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|