C21H17Cl2N7O6S2 — CID 89402252
3-[[4-[chloro-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 89402252) has the molecular formula C21H17Cl2N7O6S2 and a molecular weight of 598.45 g/mol. Its IUPAC name is 3-[[4-[chloro-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[4-[chloro-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 89402252 |
| Molecular Formula | C21H17Cl2N7O6S2 |
| Molecular Weight | 598.45 g/mol |
| Exact Mass | 597.01 |
| IUPAC Name | 3-[[4-[chloro-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | CNc1nc(Cl)nc(N(Cl)c2ccc(/N=N/c3cc(S(=O)(=O)O)c4cccc(S(=O)(=O)O)c4c3)c(C)c2)n1 |
| InChI | InChI=1S/C21H17Cl2N7O6S2/c1-11-8-13(30(23)21-26-19(22)25-20(24-2)27-21)6-7-16(11)29-28-12-9-15-14(18(10-12)38(34,35)36)4-3-5-17(15)37(31,32)33/h3-10H,1-2H3,(H,31,32,33)(H,34,35,36)(H,24,25,26,27)/b29-28+ |
| InChIKey | YEKLFORLOUULAL-ZQHSETAFSA-N |
| XLogP | 5.23 |
| TPSA | 187.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|