C25H19ClN6O8S3 — CID 20621160
3-[[4-[(4-chloro-6-ethylsulfonyl-1,3,5-triazin-2-yl)amino]naphthalen-1-yl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 20621160) has the molecular formula C25H19ClN6O8S3 and a molecular weight of 663.12 g/mol. Its IUPAC name is 3-[[4-[(4-chloro-6-ethylsulfonyl-1,3,5-triazin-2-yl)amino]naphthalen-1-yl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[4-[(4-chloro-6-ethylsulfonyl-1,3,5-triazin-2-yl)amino]naphthalen-1-yl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 20621160 |
| Molecular Formula | C25H19ClN6O8S3 |
| Molecular Weight | 663.12 g/mol |
| Exact Mass | 662.01 |
| IUPAC Name | 3-[[4-[(4-chloro-6-ethylsulfonyl-1,3,5-triazin-2-yl)amino]naphthalen-1-yl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | CCS(=O)(=O)c1nc(Cl)nc(Nc2ccc(/N=N/c3cc(S(=O)(=O)O)c4cccc(S(=O)(=O)O)c4c3)c3ccccc23)n1 |
| InChI | InChI=1S/C25H19ClN6O8S3/c1-2-41(33,34)25-29-23(26)28-24(30-25)27-19-10-11-20(16-7-4-3-6-15(16)19)32-31-14-12-18-17(22(13-14)43(38,39)40)8-5-9-21(18)42(35,36)37/h3-13H,2H2,1H3,(H,35,36,37)(H,38,39,40)(H,27,28,29,30)/b32-31+ |
| InChIKey | KURKZTVHNRFLMD-QNEJGDQOSA-N |
| XLogP | 5.28 |
| TPSA | 218.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.12 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|