C22H17Cl2N7O8S2 — CID 20764537
3-[[2-acetamido-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-methoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 20764537) has the molecular formula C22H17Cl2N7O8S2 and a molecular weight of 642.46 g/mol. Its IUPAC name is 3-[[2-acetamido-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-methoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[2-acetamido-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-methoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 20764537 |
| Molecular Formula | C22H17Cl2N7O8S2 |
| Molecular Weight | 642.46 g/mol |
| Exact Mass | 641.00 |
| IUPAC Name | 3-[[2-acetamido-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-5-methoxyphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | COc1cc(/N=N/c2cc(S(=O)(=O)O)c3cccc(S(=O)(=O)O)c3c2)c(NC(C)=O)cc1Nc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C22H17Cl2N7O8S2/c1-10(32)25-14-8-16(26-22-28-20(23)27-21(24)29-22)17(39-2)9-15(14)31-30-11-6-13-12(19(7-11)41(36,37)38)4-3-5-18(13)40(33,34)35/h3-9H,1-2H3,(H,25,32)(H,33,34,35)(H,36,37,38)(H,26,27,28,29)/b31-30+ |
| InChIKey | QCFJCFHGUMCIMO-NVQSTNCTSA-N |
| XLogP | 4.95 |
| TPSA | 222.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|