C19H14FN5O7S2 — CID 19422368
7-[[4-fluoro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 19422368) has the molecular formula C19H14FN5O7S2 and a molecular weight of 507.48 g/mol. Its IUPAC name is 7-[[4-fluoro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-[[4-fluoro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 19422368 |
| Molecular Formula | C19H14FN5O7S2 |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | 7-[[4-fluoro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2ccc(Nc3nc(F)nc(Nc4ccccc4S(=O)(=O)O)n3)cc2c1 |
| InChI | InChI=1S/C19H14FN5O7S2/c20-17-23-18(25-19(24-17)22-14-3-1-2-4-16(14)34(30,31)32)21-11-5-6-13-10(7-11)8-12(9-15(13)26)33(27,28)29/h1-9,26H,(H,27,28,29)(H,30,31,32)(H2,21,22,23,24,25) |
| InChIKey | GZHLFGGNRTVFML-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 191.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|