C19H14FN5O10S3 — CID 147198923
2-[[4-fluoro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-hydroxynaphthalene-1,7-disulfonic acid (PubChem CID 147198923) has the molecular formula C19H14FN5O10S3 and a molecular weight of 587.55 g/mol. Its IUPAC name is 2-[[4-fluoro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-hydroxynaphthalene-1,7-disulfonic acid.
| Compound Name | 2-[[4-fluoro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-hydroxynaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 147198923 |
| Molecular Formula | C19H14FN5O10S3 |
| Molecular Weight | 587.55 g/mol |
| Exact Mass | 586.99 |
| IUPAC Name | 2-[[4-fluoro-6-(3-sulfoanilino)-1,3,5-triazin-2-yl]amino]-5-hydroxynaphthalene-1,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(Nc2nc(F)nc(Nc3ccc4c(O)cc(S(=O)(=O)O)cc4c3S(=O)(=O)O)n2)c1 |
| InChI | InChI=1S/C19H14FN5O10S3/c20-17-23-18(21-9-2-1-3-10(6-9)36(27,28)29)25-19(24-17)22-14-5-4-12-13(16(14)38(33,34)35)7-11(8-15(12)26)37(30,31)32/h1-8,26H,(H,27,28,29)(H,30,31,32)(H,33,34,35)(H2,21,22,23,24,25) |
| InChIKey | CCXSHTYVTWNZMC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 246.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|