C19H23FN6O5S2 — CID 54540960
ethane;3-[[4-fluoro-6-[3-(methylsulfinyloxyamino)anilino]-1,3,5-triazin-2-yl]amino]-4-methylbenzenesulfonic acid (PubChem CID 54540960) has the molecular formula C19H23FN6O5S2 and a molecular weight of 498.56 g/mol. Its IUPAC name is ethane;3-[[4-fluoro-6-[3-(methylsulfinyloxyamino)anilino]-1,3,5-triazin-2-yl]amino]-4-methylbenzenesulfonic acid.
| Compound Name | ethane;3-[[4-fluoro-6-[3-(methylsulfinyloxyamino)anilino]-1,3,5-triazin-2-yl]amino]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 54540960 |
| Molecular Formula | C19H23FN6O5S2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | ethane;3-[[4-fluoro-6-[3-(methylsulfinyloxyamino)anilino]-1,3,5-triazin-2-yl]amino]-4-methylbenzenesulfonic acid |
| SMILES | CC.Cc1ccc(S(=O)(=O)O)cc1Nc1nc(F)nc(Nc2cccc(NOS(C)=O)c2)n1 |
| InChI | InChI=1S/C17H17FN6O5S2.C2H6/c1-10-6-7-13(31(26,27)28)9-14(10)20-17-22-15(18)21-16(23-17)19-11-4-3-5-12(8-11)24-29-30(2)25;1-2/h3-9,24H,1-2H3,(H,26,27,28)(H2,19,20,21,22,23);1-2H3 |
| InChIKey | ZDEBCQXWAIRFEU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|