C17H14ClNO4S — CID 155589443
7-[(2-chlorophenyl)methylamino]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 155589443) has the molecular formula C17H14ClNO4S and a molecular weight of 363.82 g/mol. Its IUPAC name is 7-[(2-chlorophenyl)methylamino]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-[(2-chlorophenyl)methylamino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 155589443 |
| Molecular Formula | C17H14ClNO4S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 7-[(2-chlorophenyl)methylamino]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2ccc(NCc3ccccc3Cl)cc2c1 |
| InChI | InChI=1S/C17H14ClNO4S/c18-16-4-2-1-3-11(16)10-19-13-5-6-15-12(7-13)8-14(9-17(15)20)24(21,22)23/h1-9,19-20H,10H2,(H,21,22,23) |
| InChIKey | ONZYGDRWQARZKC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|