C13H11Cl2NO — CID 5078127
2-[(3,4-dichloroanilino)methyl]phenol (PubChem CID 5078127) has the molecular formula C13H11Cl2NO and a molecular weight of 268.14 g/mol. Its IUPAC name is 2-[(3,4-dichloroanilino)methyl]phenol.
| Compound Name | 2-[(3,4-dichloroanilino)methyl]phenol |
|---|---|
| PubChem CID | 5078127 |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 2-[(3,4-dichloroanilino)methyl]phenol |
| SMILES | Oc1ccccc1CNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO/c14-11-6-5-10(7-12(11)15)16-8-9-3-1-2-4-13(9)17/h1-7,16-17H,8H2 |
| InChIKey | OGJVVKPWWOPZIX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|