C27H28N2O9S2 — CID 175244265
formaldehyde;bis(4-[(2-hydroxyphenyl)methylamino]benzenesulfonic acid) (PubChem CID 175244265) has the molecular formula C27H28N2O9S2 and a molecular weight of 588.66 g/mol. Its IUPAC name is formaldehyde;bis(4-[(2-hydroxyphenyl)methylamino]benzenesulfonic acid).
| Compound Name | formaldehyde;bis(4-[(2-hydroxyphenyl)methylamino]benzenesulfonic acid) |
|---|---|
| PubChem CID | 175244265 |
| Molecular Formula | C27H28N2O9S2 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | formaldehyde;bis(4-[(2-hydroxyphenyl)methylamino]benzenesulfonic acid) |
| SMILES | C=O.O=S(=O)(O)c1ccc(NCc2ccccc2O)cc1.O=S(=O)(O)c1ccc(NCc2ccccc2O)cc1 |
| InChI | InChI=1S/2C13H13NO4S.CH2O/c2*15-13-4-2-1-3-10(13)9-14-11-5-7-12(8-6-11)19(16,17)18;1-2/h2*1-8,14-15H,9H2,(H,16,17,18);1H2 |
| InChIKey | HZNZMJYDZLFIDP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 190.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|