C13H8F2N4O3S — CID 19897307
4-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]naphthalene-1-sulfonic acid (PubChem CID 19897307) has the molecular formula C13H8F2N4O3S and a molecular weight of 338.30 g/mol. Its IUPAC name is 4-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]naphthalene-1-sulfonic acid.
| Compound Name | 4-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 19897307 |
| Molecular Formula | C13H8F2N4O3S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 4-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]naphthalene-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Nc2nc(F)nc(F)n2)c2ccccc12 |
| InChI | InChI=1S/C13H8F2N4O3S/c14-11-17-12(15)19-13(18-11)16-9-5-6-10(23(20,21)22)8-4-2-1-3-7(8)9/h1-6H,(H,20,21,22)(H,16,17,18,19) |
| InChIKey | QQMPYMMQOUGEIF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|