C13H8F2N4O7S2 — CID 54329765
1-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]-4-hydroxynaphthalene-2,3-disulfonic acid (PubChem CID 54329765) has the molecular formula C13H8F2N4O7S2 and a molecular weight of 434.36 g/mol. Its IUPAC name is 1-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]-4-hydroxynaphthalene-2,3-disulfonic acid.
| Compound Name | 1-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]-4-hydroxynaphthalene-2,3-disulfonic acid |
|---|---|
| PubChem CID | 54329765 |
| Molecular Formula | C13H8F2N4O7S2 |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | 1-[(4,6-difluoro-1,3,5-triazin-2-yl)amino]-4-hydroxynaphthalene-2,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1c(S(=O)(=O)O)c(Nc2nc(F)nc(F)n2)c2ccccc2c1O |
| InChI | InChI=1S/C13H8F2N4O7S2/c14-11-17-12(15)19-13(18-11)16-7-5-3-1-2-4-6(5)8(20)10(28(24,25)26)9(7)27(21,22)23/h1-4,20H,(H,21,22,23)(H,24,25,26)(H,16,17,18,19) |
| InChIKey | SXMPVLPTBIPLLC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 179.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|