C14H11ClN4O3S — CID 58879252
2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalene-1-sulfonic acid (PubChem CID 58879252) has the molecular formula C14H11ClN4O3S and a molecular weight of 350.79 g/mol. Its IUPAC name is 2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalene-1-sulfonic acid.
| Compound Name | 2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 58879252 |
| Molecular Formula | C14H11ClN4O3S |
| Molecular Weight | 350.79 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 2-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalene-1-sulfonic acid |
| SMILES | Cc1nc(Cl)nc(Nc2ccc3ccccc3c2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C14H11ClN4O3S/c1-8-16-13(15)19-14(17-8)18-11-7-6-9-4-2-3-5-10(9)12(11)23(20,21)22/h2-7H,1H3,(H,20,21,22)(H,16,17,18,19) |
| InChIKey | NYFMSYMQCBZEAD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.79 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|