C19H23N5O4S — CID 162033902
4-[[4-(3,4-dimethylanilino)-6-oxo-1H-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid;methane (PubChem CID 162033902) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is 4-[[4-(3,4-dimethylanilino)-6-oxo-1H-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid;methane.
| Compound Name | 4-[[4-(3,4-dimethylanilino)-6-oxo-1H-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid;methane |
|---|---|
| PubChem CID | 162033902 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-[[4-(3,4-dimethylanilino)-6-oxo-1H-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid;methane |
| SMILES | C.Cc1ccc(Nc2nc(Nc3ccc(S(=O)(=O)O)c(C)c3)[nH]c(=O)n2)cc1C |
| InChI | InChI=1S/C18H19N5O4S.CH4/c1-10-4-5-13(8-11(10)2)19-16-21-17(23-18(24)22-16)20-14-6-7-15(12(3)9-14)28(25,26)27;/h4-9H,1-3H3,(H,25,26,27)(H3,19,20,21,22,23,24);1H4 |
| InChIKey | YWJWBDQNXKVSEC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|