C33H27N9O11S3 — CID 136656444
7-[[4-[[4-[2-methoxy-4-[(3-sulfophenyl)diazenyl]anilino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 136656444) has the molecular formula C33H27N9O11S3 and a molecular weight of 821.83 g/mol. Its IUPAC name is 7-[[4-[[4-[2-methoxy-4-[(3-sulfophenyl)diazenyl]anilino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 7-[[4-[[4-[2-methoxy-4-[(3-sulfophenyl)diazenyl]anilino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 136656444 |
| Molecular Formula | C33H27N9O11S3 |
| Molecular Weight | 821.83 g/mol |
| Exact Mass | 821.10 |
| IUPAC Name | 7-[[4-[[4-[2-methoxy-4-[(3-sulfophenyl)diazenyl]anilino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]-2-methylphenyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | COc1cc(/N=N/c2cccc(S(=O)(=O)O)c2)ccc1Nc1nc(Nc2ccc(/N=N/c3ccc4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c4c3)c(C)c2)[nH]c(=O)n1 |
| InChI | InChI=1S/C33H27N9O11S3/c1-18-12-20(8-10-27(18)42-41-22-7-6-19-13-25(55(47,48)49)17-30(26(19)15-22)56(50,51)52)34-31-36-32(38-33(43)37-31)35-28-11-9-23(16-29(28)53-2)40-39-21-4-3-5-24(14-21)54(44,45)46/h3-17H,1-2H3,(H,44,45,46)(H,47,48,49)(H,50,51,52)(H3,34,35,36,37,38,43)/b40-39+,42-41+ |
| InChIKey | MBTQQRVFGQGEBG-HHKNSCEGSA-N |
| XLogP | 6.69 |
| TPSA | 304.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.83 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|