C19H17N6O6S+ — CID 137136352
2-[[2-[(2-ethyl-1,3-dioxoisoindol-2-ium-5-yl)amino]-6-oxo-1H-1,3,5-triazin-4-yl]amino]benzenesulfonic acid (PubChem CID 137136352) has the molecular formula C19H17N6O6S+ and a molecular weight of 457.45 g/mol. Its IUPAC name is 2-[[2-[(2-ethyl-1,3-dioxoisoindol-2-ium-5-yl)amino]-6-oxo-1H-1,3,5-triazin-4-yl]amino]benzenesulfonic acid.
| Compound Name | 2-[[2-[(2-ethyl-1,3-dioxoisoindol-2-ium-5-yl)amino]-6-oxo-1H-1,3,5-triazin-4-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 137136352 |
| Molecular Formula | C19H17N6O6S+ |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-[[2-[(2-ethyl-1,3-dioxoisoindol-2-ium-5-yl)amino]-6-oxo-1H-1,3,5-triazin-4-yl]amino]benzenesulfonic acid |
| SMILES | CC[NH+]1C(=O)c2ccc(Nc3nc(Nc4ccccc4S(=O)(=O)O)nc(=O)[nH]3)cc2C1=O |
| InChI | InChI=1S/C19H16N6O6S/c1-2-25-15(26)11-8-7-10(9-12(11)16(25)27)20-17-22-18(24-19(28)23-17)21-13-5-3-4-6-14(13)32(29,30)31/h3-9H,2H2,1H3,(H,29,30,31)(H3,20,21,22,23,24,28)/p+1 |
| InChIKey | BZALWHKGMBERLM-UHFFFAOYSA-O |
| XLogP | 0.10 |
| TPSA | 175.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|