C22H17F2N9O13S3 — CID 21343150
2-[[4-fluoro-6-[3-(5-fluoro-2,4-dinitroanilino)-4-sulfoanilino]-1,3,5-triazin-2-yl]amino]-5-(methylamino)benzene-1,4-disulfonic acid (PubChem CID 21343150) has the molecular formula C22H17F2N9O13S3 and a molecular weight of 749.62 g/mol. Its IUPAC name is 2-[[4-fluoro-6-[3-(5-fluoro-2,4-dinitroanilino)-4-sulfoanilino]-1,3,5-triazin-2-yl]amino]-5-(methylamino)benzene-1,4-disulfonic acid.
| Compound Name | 2-[[4-fluoro-6-[3-(5-fluoro-2,4-dinitroanilino)-4-sulfoanilino]-1,3,5-triazin-2-yl]amino]-5-(methylamino)benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 21343150 |
| Molecular Formula | C22H17F2N9O13S3 |
| Molecular Weight | 749.62 g/mol |
| Exact Mass | 749.01 |
| IUPAC Name | 2-[[4-fluoro-6-[3-(5-fluoro-2,4-dinitroanilino)-4-sulfoanilino]-1,3,5-triazin-2-yl]amino]-5-(methylamino)benzene-1,4-disulfonic acid |
| SMILES | CNc1cc(S(=O)(=O)O)c(Nc2nc(F)nc(Nc3ccc(S(=O)(=O)O)c(Nc4cc(F)c([N+](=O)[O-])cc4[N+](=O)[O-])c3)n2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C22H17F2N9O13S3/c1-25-12-6-19(49(44,45)46)14(7-18(12)48(41,42)43)28-22-30-20(24)29-21(31-22)26-9-2-3-17(47(38,39)40)13(4-9)27-11-5-10(23)15(32(34)35)8-16(11)33(36)37/h2-8,25,27H,1H3,(H,38,39,40)(H,41,42,43)(H,44,45,46)(H2,26,28,29,30,31) |
| InChIKey | DVCXZWPOFWIXAV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 336.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|