C18H16F2N8O10S2 — CID 21343159
2-(5-fluoro-2,4-dinitroanilino)-5-[[4-fluoro-6-(propylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid (PubChem CID 21343159) has the molecular formula C18H16F2N8O10S2 and a molecular weight of 606.50 g/mol. Its IUPAC name is 2-(5-fluoro-2,4-dinitroanilino)-5-[[4-fluoro-6-(propylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-(5-fluoro-2,4-dinitroanilino)-5-[[4-fluoro-6-(propylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 21343159 |
| Molecular Formula | C18H16F2N8O10S2 |
| Molecular Weight | 606.50 g/mol |
| Exact Mass | 606.04 |
| IUPAC Name | 2-(5-fluoro-2,4-dinitroanilino)-5-[[4-fluoro-6-(propylamino)-1,3,5-triazin-2-yl]amino]benzene-1,4-disulfonic acid |
| SMILES | CCCNc1nc(F)nc(Nc2cc(S(=O)(=O)O)c(Nc3cc(F)c([N+](=O)[O-])cc3[N+](=O)[O-])cc2S(=O)(=O)O)n1 |
| InChI | InChI=1S/C18H16F2N8O10S2/c1-2-3-21-17-24-16(20)25-18(26-17)23-11-6-14(39(33,34)35)10(5-15(11)40(36,37)38)22-9-4-8(19)12(27(29)30)7-13(9)28(31)32/h4-7,22H,2-3H2,1H3,(H,33,34,35)(H,36,37,38)(H2,21,23,24,25,26) |
| InChIKey | ZBBLANZKYWTTHK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 269.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|