C15H15FN2O5S — CID 21343205
4-(5-fluoro-4-methyl-2-nitroanilino)-2,5-dimethylbenzenesulfonic acid (PubChem CID 21343205) has the molecular formula C15H15FN2O5S and a molecular weight of 354.36 g/mol. Its IUPAC name is 4-(5-fluoro-4-methyl-2-nitroanilino)-2,5-dimethylbenzenesulfonic acid.
| Compound Name | 4-(5-fluoro-4-methyl-2-nitroanilino)-2,5-dimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 21343205 |
| Molecular Formula | C15H15FN2O5S |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 4-(5-fluoro-4-methyl-2-nitroanilino)-2,5-dimethylbenzenesulfonic acid |
| SMILES | Cc1cc([N+](=O)[O-])c(Nc2cc(C)c(S(=O)(=O)O)cc2C)cc1F |
| InChI | InChI=1S/C15H15FN2O5S/c1-8-5-14(18(19)20)13(7-11(8)16)17-12-4-10(3)15(6-9(12)2)24(21,22)23/h4-7,17H,1-3H3,(H,21,22,23) |
| InChIKey | ZWSNKXCMXQVBEJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|