C12H11N3O8S2 — CID 88722805
2-amino-4-(2-nitro-4-sulfoanilino)benzenesulfonic acid (PubChem CID 88722805) has the molecular formula C12H11N3O8S2 and a molecular weight of 389.37 g/mol. Its IUPAC name is 2-amino-4-(2-nitro-4-sulfoanilino)benzenesulfonic acid.
| Compound Name | 2-amino-4-(2-nitro-4-sulfoanilino)benzenesulfonic acid |
|---|---|
| PubChem CID | 88722805 |
| Molecular Formula | C12H11N3O8S2 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 2-amino-4-(2-nitro-4-sulfoanilino)benzenesulfonic acid |
| SMILES | Nc1cc(Nc2ccc(S(=O)(=O)O)cc2[N+](=O)[O-])ccc1S(=O)(=O)O |
| InChI | InChI=1S/C12H11N3O8S2/c13-9-5-7(1-4-12(9)25(21,22)23)14-10-3-2-8(24(18,19)20)6-11(10)15(16)17/h1-6,14H,13H2,(H,18,19,20)(H,21,22,23) |
| InChIKey | IBKMASJWQUDJKZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 189.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|