C12H7Cl3N8O3S — CID 57022345
5-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid (PubChem CID 57022345) has the molecular formula C12H7Cl3N8O3S and a molecular weight of 449.67 g/mol. Its IUPAC name is 5-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid.
| Compound Name | 5-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 57022345 |
| Molecular Formula | C12H7Cl3N8O3S |
| Molecular Weight | 449.67 g/mol |
| Exact Mass | 447.94 |
| IUPAC Name | 5-[(4-chloro-1,3,5-triazin-2-yl)amino]-2-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(Nc2ncnc(Cl)n2)ccc1Nc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C12H7Cl3N8O3S/c13-8-16-4-17-11(21-8)18-5-1-2-6(7(3-5)27(24,25)26)19-12-22-9(14)20-10(15)23-12/h1-4H,(H,24,25,26)(H,16,17,18,21)(H,19,20,22,23) |
| InChIKey | CPWWGJFJTJLTEZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 155.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.67 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|