About N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide
N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide (PubChem CID 145360463) has the molecular formula C13H18N6O2S
and a molecular weight of 322.39 g/mol. Its IUPAC name is N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide |
| PubChem CID | 145360463 |
| Molecular Formula | C13H18N6O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide |
| SMILES | CNc1cnc(Nc2ccc(NS(C)(=O)=O)cc2)nc1NC |
| InChI | InChI=1S/C13H18N6O2S/c1-14-11-8-16-13(18-12(11)15-2)17-9-4-6-10(7-5-9)19-22(3,20)21/h4-8,14,19H,1-3H3,(H2,15,16,17,18) |
| InChIKey | XKNAKUPOJLISAT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide?
The IUPAC name of N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide (CID 145360463) is N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide.
What is the SMILES notation for N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide?
The canonical SMILES for N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide is CNc1cnc(Nc2ccc(NS(C)(=O)=O)cc2)nc1NC.
What is the InChIKey of N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide?
The InChIKey is XKNAKUPOJLISAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N6O2S/c1-14-11-8-16-13(18-12(11)15-2)17-9-4-6-10(7-5-9)19-22(3,20)21/h4-8,14,19H,1-3H3,(H2,15,16,17,18).
What are the key properties of N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide?
N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide has a molecular weight of 322.39 g/mol, XLogP of 1.68, 6 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[4,5-bis(methylamino)pyrimidin-2-yl]amino]phenyl]methanesulfonamide is sourced from PubChem (CID 145360463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).