C21H21N5O3S2 — CID 59491615
N-[4-[2-[4-(methanesulfonamido)anilino]-5-methylpyrimidin-4-yl]sulfanylphenyl]prop-2-enamide (PubChem CID 59491615) has the molecular formula C21H21N5O3S2 and a molecular weight of 455.57 g/mol. Its IUPAC name is N-[4-[2-[4-(methanesulfonamido)anilino]-5-methylpyrimidin-4-yl]sulfanylphenyl]prop-2-enamide.
| Compound Name | N-[4-[2-[4-(methanesulfonamido)anilino]-5-methylpyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59491615 |
| Molecular Formula | C21H21N5O3S2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[4-[2-[4-(methanesulfonamido)anilino]-5-methylpyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Sc2nc(Nc3ccc(NS(C)(=O)=O)cc3)ncc2C)cc1 |
| InChI | InChI=1S/C21H21N5O3S2/c1-4-19(27)23-15-9-11-18(12-10-15)30-20-14(2)13-22-21(25-20)24-16-5-7-17(8-6-16)26-31(3,28)29/h4-13,26H,1H2,2-3H3,(H,23,27)(H,22,24,25) |
| InChIKey | VVFYUENKNWKFKK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|