C19H17ClN4OS2 — CID 59491803
2-chloro-N-[4-[5-methyl-2-(3-sulfanylanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide (PubChem CID 59491803) has the molecular formula C19H17ClN4OS2 and a molecular weight of 416.96 g/mol. Its IUPAC name is 2-chloro-N-[4-[5-methyl-2-(3-sulfanylanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide.
| Compound Name | 2-chloro-N-[4-[5-methyl-2-(3-sulfanylanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 59491803 |
| Molecular Formula | C19H17ClN4OS2 |
| Molecular Weight | 416.96 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 2-chloro-N-[4-[5-methyl-2-(3-sulfanylanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide |
| SMILES | Cc1cnc(Nc2cccc(S)c2)nc1Sc1ccc(NC(=O)CCl)cc1 |
| InChI | InChI=1S/C19H17ClN4OS2/c1-12-11-21-19(23-14-3-2-4-15(26)9-14)24-18(12)27-16-7-5-13(6-8-16)22-17(25)10-20/h2-9,11,26H,10H2,1H3,(H,22,25)(H,21,23,24) |
| InChIKey | VQMOCIIYXDWXOJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.96 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|