C27H27N5O3S — CID 59491439
3-(3-methoxyanilino)-N-[4-[2-(3-methoxyanilino)pyrimidin-4-yl]sulfanylphenyl]propanamide (PubChem CID 59491439) has the molecular formula C27H27N5O3S and a molecular weight of 501.61 g/mol. Its IUPAC name is 3-(3-methoxyanilino)-N-[4-[2-(3-methoxyanilino)pyrimidin-4-yl]sulfanylphenyl]propanamide.
| Compound Name | 3-(3-methoxyanilino)-N-[4-[2-(3-methoxyanilino)pyrimidin-4-yl]sulfanylphenyl]propanamide |
|---|---|
| PubChem CID | 59491439 |
| Molecular Formula | C27H27N5O3S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 3-(3-methoxyanilino)-N-[4-[2-(3-methoxyanilino)pyrimidin-4-yl]sulfanylphenyl]propanamide |
| SMILES | COc1cccc(NCCC(=O)Nc2ccc(Sc3ccnc(Nc4cccc(OC)c4)n3)cc2)c1 |
| InChI | InChI=1S/C27H27N5O3S/c1-34-22-7-3-5-20(17-22)28-15-13-25(33)30-19-9-11-24(12-10-19)36-26-14-16-29-27(32-26)31-21-6-4-8-23(18-21)35-2/h3-12,14,16-18,28H,13,15H2,1-2H3,(H,30,33)(H,29,31,32) |
| InChIKey | VUQCNSJVOCFXTE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |