C19H15ClN4OS — CID 59491494
N-[4-[2-(3-chloroanilino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide (PubChem CID 59491494) has the molecular formula C19H15ClN4OS and a molecular weight of 382.88 g/mol. Its IUPAC name is N-[4-[2-(3-chloroanilino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide.
| Compound Name | N-[4-[2-(3-chloroanilino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59491494 |
| Molecular Formula | C19H15ClN4OS |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N-[4-[2-(3-chloroanilino)pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Sc2ccnc(Nc3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C19H15ClN4OS/c1-2-17(25)22-14-6-8-16(9-7-14)26-18-10-11-21-19(24-18)23-15-5-3-4-13(20)12-15/h2-12H,1H2,(H,22,25)(H,21,23,24) |
| InChIKey | SDMOWBKGUMAEBE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|