C24H27N5O3S2 — CID 59491600
N-[4-[2-[3-(3-methylbutylsulfamoyl)anilino]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide (PubChem CID 59491600) has the molecular formula C24H27N5O3S2 and a molecular weight of 497.65 g/mol. Its IUPAC name is N-[4-[2-[3-(3-methylbutylsulfamoyl)anilino]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide.
| Compound Name | N-[4-[2-[3-(3-methylbutylsulfamoyl)anilino]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59491600 |
| Molecular Formula | C24H27N5O3S2 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-[4-[2-[3-(3-methylbutylsulfamoyl)anilino]pyrimidin-4-yl]sulfanylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Sc2ccnc(Nc3cccc(S(=O)(=O)NCCC(C)C)c3)n2)cc1 |
| InChI | InChI=1S/C24H27N5O3S2/c1-4-22(30)27-18-8-10-20(11-9-18)33-23-13-14-25-24(29-23)28-19-6-5-7-21(16-19)34(31,32)26-15-12-17(2)3/h4-11,13-14,16-17,26H,1,12,15H2,2-3H3,(H,27,30)(H,25,28,29) |
| InChIKey | HQKYHAIMYKGTLZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|