C26H24N5O3S2+ — CID 143728213
N-[4-[2-[3-(benzylsulfamoyl)anilino]pyrimidin-1-ium-4-yl]sulfanylphenyl]prop-2-enamide (PubChem CID 143728213) has the molecular formula C26H24N5O3S2+ and a molecular weight of 518.64 g/mol. Its IUPAC name is N-[4-[2-[3-(benzylsulfamoyl)anilino]pyrimidin-1-ium-4-yl]sulfanylphenyl]prop-2-enamide.
| Compound Name | N-[4-[2-[3-(benzylsulfamoyl)anilino]pyrimidin-1-ium-4-yl]sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 143728213 |
| Molecular Formula | C26H24N5O3S2+ |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | N-[4-[2-[3-(benzylsulfamoyl)anilino]pyrimidin-1-ium-4-yl]sulfanylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Sc2cc[nH+]c(Nc3cccc(S(=O)(=O)NCc4ccccc4)c3)n2)cc1 |
| InChI | InChI=1S/C26H23N5O3S2/c1-2-24(32)29-20-11-13-22(14-12-20)35-25-15-16-27-26(31-25)30-21-9-6-10-23(17-21)36(33,34)28-18-19-7-4-3-5-8-19/h2-17,28H,1,18H2,(H,29,32)(H,27,30,31)/p+1 |
| InChIKey | VCQOFTRLDBXNAC-UHFFFAOYSA-O |
| XLogP | 4.39 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|