C18H18ClN3O2S — CID 18794206
[3-[[4-(3-methoxyphenyl)sulfanylpyrimidin-2-yl]amino]phenyl]methanol;hydrochloride (PubChem CID 18794206) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is [3-[[4-(3-methoxyphenyl)sulfanylpyrimidin-2-yl]amino]phenyl]methanol;hydrochloride.
| Compound Name | [3-[[4-(3-methoxyphenyl)sulfanylpyrimidin-2-yl]amino]phenyl]methanol;hydrochloride |
|---|---|
| PubChem CID | 18794206 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [3-[[4-(3-methoxyphenyl)sulfanylpyrimidin-2-yl]amino]phenyl]methanol;hydrochloride |
| SMILES | COc1cccc(Sc2ccnc(Nc3cccc(CO)c3)n2)c1.Cl |
| InChI | InChI=1S/C18H17N3O2S.ClH/c1-23-15-6-3-7-16(11-15)24-17-8-9-19-18(21-17)20-14-5-2-4-13(10-14)12-22;/h2-11,22H,12H2,1H3,(H,19,20,21);1H |
| InChIKey | MQFQQJPMSVMANA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |