C8H7ClN4O2S2 — CID 3395522
N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chlorobenzenesulfonamide (PubChem CID 3395522) has the molecular formula C8H7ClN4O2S2 and a molecular weight of 290.76 g/mol. Its IUPAC name is N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chlorobenzenesulfonamide.
| Compound Name | N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 3395522 |
| Molecular Formula | C8H7ClN4O2S2 |
| Molecular Weight | 290.76 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | N-(5-amino-1,2,4-thiadiazol-3-yl)-2-chlorobenzenesulfonamide |
| SMILES | Nc1nc(NS(=O)(=O)c2ccccc2Cl)ns1 |
| InChI | InChI=1S/C8H7ClN4O2S2/c9-5-3-1-2-4-6(5)17(14,15)13-8-11-7(10)16-12-8/h1-4H,(H3,10,11,12,13) |
| InChIKey | DNBNNLQKPCDBJA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.76 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |