C10H10ClN3O4S3 — CID 63946233
2-[(2-chlorophenyl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 63946233) has the molecular formula C10H10ClN3O4S3 and a molecular weight of 367.86 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-[(2-chlorophenyl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 63946233 |
| Molecular Formula | C10H10ClN3O4S3 |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | 2-[(2-chlorophenyl)sulfonylamino]-4-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2ccccc2Cl)sc1S(N)(=O)=O |
| InChI | InChI=1S/C10H10ClN3O4S3/c1-6-9(20(12,15)16)19-10(13-6)14-21(17,18)8-5-3-2-4-7(8)11/h2-5H,1H3,(H,13,14)(H2,12,15,16) |
| InChIKey | CVIZGQIKWGOFGX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |