C13H9ClN4O2S2 — CID 118077526
2-chloro-N-(3-pyridin-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 118077526) has the molecular formula C13H9ClN4O2S2 and a molecular weight of 352.83 g/mol. Its IUPAC name is 2-chloro-N-(3-pyridin-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(3-pyridin-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118077526 |
| Molecular Formula | C13H9ClN4O2S2 |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 2-chloro-N-(3-pyridin-2-yl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2ccccn2)ns1)c1ccccc1Cl |
| InChI | InChI=1S/C13H9ClN4O2S2/c14-9-5-1-2-7-11(9)22(19,20)18-13-16-12(17-21-13)10-6-3-4-8-15-10/h1-8H,(H,16,17,18) |
| InChIKey | WLGNMKNMCQEPPX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |