About 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide
3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide (PubChem CID 21081335) has the molecular formula C10H10ClN3O3S2
and a molecular weight of 319.80 g/mol. Its IUPAC name is 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide |
| PubChem CID | 21081335 |
| Molecular Formula | C10H10ClN3O3S2 |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide |
| SMILES | COc1nsc(NS(=O)(=O)c2cccc(Cl)c2C)n1 |
| InChI | InChI=1S/C10H10ClN3O3S2/c1-6-7(11)4-3-5-8(6)19(15,16)14-10-12-9(17-2)13-18-10/h3-5H,1-2H3,(H,12,13,14) |
| InChIKey | NJBBIIISNCFRFQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide?
The IUPAC name of 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide (CID 21081335) is 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide.
What is the SMILES notation for 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide?
The canonical SMILES for 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide is COc1nsc(NS(=O)(=O)c2cccc(Cl)c2C)n1.
What is the InChIKey of 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide?
The InChIKey is NJBBIIISNCFRFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3O3S2/c1-6-7(11)4-3-5-8(6)19(15,16)14-10-12-9(17-2)13-18-10/h3-5H,1-2H3,(H,12,13,14).
What are the key properties of 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide?
3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide has a molecular weight of 319.80 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-2-methylbenzenesulfonamide is sourced from PubChem (CID 21081335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).