C11H14N4S — CID 65268791
N-(2-methylpropyl)-3-pyridin-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 65268791) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is N-(2-methylpropyl)-3-pyridin-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-methylpropyl)-3-pyridin-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65268791 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | N-(2-methylpropyl)-3-pyridin-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)CNc1nc(-c2ccccn2)ns1 |
| InChI | InChI=1S/C11H14N4S/c1-8(2)7-13-11-14-10(15-16-11)9-5-3-4-6-12-9/h3-6,8H,7H2,1-2H3,(H,13,14,15) |
| InChIKey | ZYEKMQAWWPLPOT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |