C17H11N5OS — CID 122555332
N-(3-pyridin-2-yl-1,2,4-thiadiazol-5-yl)isoquinoline-7-carboxamide (PubChem CID 122555332) has the molecular formula C17H11N5OS and a molecular weight of 333.38 g/mol. Its IUPAC name is N-(3-pyridin-2-yl-1,2,4-thiadiazol-5-yl)isoquinoline-7-carboxamide.
| Compound Name | N-(3-pyridin-2-yl-1,2,4-thiadiazol-5-yl)isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 122555332 |
| Molecular Formula | C17H11N5OS |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-(3-pyridin-2-yl-1,2,4-thiadiazol-5-yl)isoquinoline-7-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccn2)ns1)c1ccc2ccncc2c1 |
| InChI | InChI=1S/C17H11N5OS/c23-16(12-5-4-11-6-8-18-10-13(11)9-12)21-17-20-15(22-24-17)14-3-1-2-7-19-14/h1-10H,(H,20,21,22,23) |
| InChIKey | GPXMIOCGSOOOME-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |