C20H13ClN4OS — CID 99718268
2-chloro-N-(3-phenyl-1,2,4-thiadiazol-5-yl)-5-pyridin-2-ylbenzamide (PubChem CID 99718268) has the molecular formula C20H13ClN4OS and a molecular weight of 392.87 g/mol. Its IUPAC name is 2-chloro-N-(3-phenyl-1,2,4-thiadiazol-5-yl)-5-pyridin-2-ylbenzamide.
| Compound Name | 2-chloro-N-(3-phenyl-1,2,4-thiadiazol-5-yl)-5-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 99718268 |
| Molecular Formula | C20H13ClN4OS |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 2-chloro-N-(3-phenyl-1,2,4-thiadiazol-5-yl)-5-pyridin-2-ylbenzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)ns1)c1cc(-c2ccccn2)ccc1Cl |
| InChI | InChI=1S/C20H13ClN4OS/c21-16-10-9-14(17-8-4-5-11-22-17)12-15(16)19(26)24-20-23-18(25-27-20)13-6-2-1-3-7-13/h1-12H,(H,23,24,25,26) |
| InChIKey | SDRCMCYJUMHGPE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |