C10H10N8S2 — CID 139226799
5-[2-(5-anilino-1,3,4-thiadiazol-2-yl)hydrazinyl]-1,3,4-thiadiazol-2-amine (PubChem CID 139226799) has the molecular formula C10H10N8S2 and a molecular weight of 306.38 g/mol. Its IUPAC name is 5-[2-(5-anilino-1,3,4-thiadiazol-2-yl)hydrazinyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(5-anilino-1,3,4-thiadiazol-2-yl)hydrazinyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 139226799 |
| Molecular Formula | C10H10N8S2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 5-[2-(5-anilino-1,3,4-thiadiazol-2-yl)hydrazinyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(NNc2nnc(Nc3ccccc3)s2)s1 |
| InChI | InChI=1S/C10H10N8S2/c11-7-13-15-9(19-7)16-18-10-17-14-8(20-10)12-6-4-2-1-3-5-6/h1-5H,(H2,11,13)(H,12,14)(H,15,16)(H,17,18) |
| InChIKey | JUOVIGFJZDMMGD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|