C11H11N3S — CID 156770998
5-cyclopropyl-N-phenyl-1,3,4-thiadiazol-2-amine (PubChem CID 156770998) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is 5-cyclopropyl-N-phenyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-cyclopropyl-N-phenyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 156770998 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 5-cyclopropyl-N-phenyl-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc(Nc2nnc(C3CC3)s2)cc1 |
| InChI | InChI=1S/C11H11N3S/c1-2-4-9(5-3-1)12-11-14-13-10(15-11)8-6-7-8/h1-5,8H,6-7H2,(H,12,14) |
| InChIKey | QUDFIBCYCTUAGR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |