C13H15N3OS — CID 102060593
trans-(1S,2S)-2-(5-anilino-1,3,4-thiadiazol-2-yl)cyclopentan-1-ol (PubChem CID 102060593) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is trans-(1S,2S)-2-(5-anilino-1,3,4-thiadiazol-2-yl)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(5-anilino-1,3,4-thiadiazol-2-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102060593 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | trans-(1S,2S)-2-(5-anilino-1,3,4-thiadiazol-2-yl)cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1c1nnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C13H15N3OS/c17-11-8-4-7-10(11)12-15-16-13(18-12)14-9-5-2-1-3-6-9/h1-3,5-6,10-11,17H,4,7-8H2,(H,14,16)/t10-,11-/m0/s1 |
| InChIKey | VUXHGMBLABCZTE-QWRGUYRKSA-N |
| XLogP | 2.91 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |