C12H13N3S — CID 131017877
N-benzyl-5-cyclopropyl-1,3,4-thiadiazol-2-amine (PubChem CID 131017877) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is N-benzyl-5-cyclopropyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-benzyl-5-cyclopropyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 131017877 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | N-benzyl-5-cyclopropyl-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc(CNc2nnc(C3CC3)s2)cc1 |
| InChI | InChI=1S/C12H13N3S/c1-2-4-9(5-3-1)8-13-12-15-14-11(16-12)10-6-7-10/h1-5,10H,6-8H2,(H,13,15) |
| InChIKey | BZVIGMFGXJARGH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |