C17H22N4S — CID 133366013
N-(1-benzylpiperidin-4-yl)-5-cyclopropyl-1,3,4-thiadiazol-2-amine (PubChem CID 133366013) has the molecular formula C17H22N4S and a molecular weight of 314.46 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-5-cyclopropyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(1-benzylpiperidin-4-yl)-5-cyclopropyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133366013 |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-5-cyclopropyl-1,3,4-thiadiazol-2-amine |
| SMILES | c1ccc(CN2CCC(Nc3nnc(C4CC4)s3)CC2)cc1 |
| InChI | InChI=1S/C17H22N4S/c1-2-4-13(5-3-1)12-21-10-8-15(9-11-21)18-17-20-19-16(22-17)14-6-7-14/h1-5,14-15H,6-12H2,(H,18,20) |
| InChIKey | VIMJKZDZDZWUAG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |