C14H18N4S — CID 131889047
N-(1-ethylpyrrolidin-3-yl)-5-phenyl-1,3,4-thiadiazol-2-amine (PubChem CID 131889047) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-(1-ethylpyrrolidin-3-yl)-5-phenyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(1-ethylpyrrolidin-3-yl)-5-phenyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 131889047 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-(1-ethylpyrrolidin-3-yl)-5-phenyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCN1CCC(Nc2nnc(-c3ccccc3)s2)C1 |
| InChI | InChI=1S/C14H18N4S/c1-2-18-9-8-12(10-18)15-14-17-16-13(19-14)11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3,(H,15,17) |
| InChIKey | UNJNBHBKAVQXCY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |