C18H15N3OS — CID 4812441
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-phenylbenzamide (PubChem CID 4812441) has the molecular formula C18H15N3OS and a molecular weight of 321.40 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-phenylbenzamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-phenylbenzamide |
|---|---|
| PubChem CID | 4812441 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-phenylbenzamide |
| SMILES | O=C(Nc1nnc(C2CC2)s1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C18H15N3OS/c22-16(19-18-21-20-17(23-18)13-10-11-13)15-9-5-4-8-14(15)12-6-2-1-3-7-12/h1-9,13H,10-11H2,(H,19,21,22) |
| InChIKey | IVVCQPHGSGGYNC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |