C15H12N4OS — CID 17402298
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)quinoline-2-carboxamide (PubChem CID 17402298) has the molecular formula C15H12N4OS and a molecular weight of 296.35 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)quinoline-2-carboxamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 17402298 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)quinoline-2-carboxamide |
| SMILES | O=C(Nc1nnc(C2CC2)s1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H12N4OS/c20-13(17-15-19-18-14(21-15)10-5-6-10)12-8-7-9-3-1-2-4-11(9)16-12/h1-4,7-8,10H,5-6H2,(H,17,19,20) |
| InChIKey | NAPUCIXSDZJMIK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |