C14H15N3OS — CID 8503017
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2,3-dimethylbenzamide (PubChem CID 8503017) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2,3-dimethylbenzamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 8503017 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2nnc(C3CC3)s2)c1C |
| InChI | InChI=1S/C14H15N3OS/c1-8-4-3-5-11(9(8)2)12(18)15-14-17-16-13(19-14)10-6-7-10/h3-5,10H,6-7H2,1-2H3,(H,15,17,18) |
| InChIKey | MNPHAPQJEOQKTG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |