C11H12N4OS — CID 79513455
N-(5-amino-1,3,4-thiadiazol-2-yl)-2,3-dimethylbenzamide (PubChem CID 79513455) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is N-(5-amino-1,3,4-thiadiazol-2-yl)-2,3-dimethylbenzamide.
| Compound Name | N-(5-amino-1,3,4-thiadiazol-2-yl)-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 79513455 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N-(5-amino-1,3,4-thiadiazol-2-yl)-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2nnc(N)s2)c1C |
| InChI | InChI=1S/C11H12N4OS/c1-6-4-3-5-8(7(6)2)9(16)13-11-15-14-10(12)17-11/h3-5H,1-2H3,(H2,12,14)(H,13,15,16) |
| InChIKey | SNOPGHKTQZJIAX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |