C15H16IN3OS — CID 1035124
N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-iodobenzamide (PubChem CID 1035124) has the molecular formula C15H16IN3OS and a molecular weight of 413.28 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-iodobenzamide.
| Compound Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-iodobenzamide |
|---|---|
| PubChem CID | 1035124 |
| Molecular Formula | C15H16IN3OS |
| Molecular Weight | 413.28 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-2-iodobenzamide |
| SMILES | O=C(Nc1nnc(C2CCCCC2)s1)c1ccccc1I |
| InChI | InChI=1S/C15H16IN3OS/c16-12-9-5-4-8-11(12)13(20)17-15-19-18-14(21-15)10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2,(H,17,19,20) |
| InChIKey | LOLKFLJKXJMZLD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|