C16H17N3O3S — CID 146022284
benzyl 4-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate (PubChem CID 146022284) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is benzyl 4-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate.
| Compound Name | benzyl 4-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 146022284 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | benzyl 4-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCc1ccccc1)Nc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C16H17N3O3S/c20-13(17-16-19-18-15(23-16)12-6-7-12)8-9-14(21)22-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,17,19,20) |
| InChIKey | QQKUTIYJPXWFIR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |