C18H21BrN4O2S — CID 1398596
N-(3-bromophenyl)-N'-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)butanediamide (PubChem CID 1398596) has the molecular formula C18H21BrN4O2S and a molecular weight of 437.36 g/mol. Its IUPAC name is N-(3-bromophenyl)-N'-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)butanediamide.
| Compound Name | N-(3-bromophenyl)-N'-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 1398596 |
| Molecular Formula | C18H21BrN4O2S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | N-(3-bromophenyl)-N'-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)butanediamide |
| SMILES | O=C(CCC(=O)Nc1nnc(C2CCCCC2)s1)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C18H21BrN4O2S/c19-13-7-4-8-14(11-13)20-15(24)9-10-16(25)21-18-23-22-17(26-18)12-5-2-1-3-6-12/h4,7-8,11-12H,1-3,5-6,9-10H2,(H,20,24)(H,21,23,25) |
| InChIKey | SBPSEGPFZKOLNU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |