C19H23N3O2S — CID 108807587
N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-5-oxo-5-phenylpentanamide (PubChem CID 108807587) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-5-oxo-5-phenylpentanamide.
| Compound Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-5-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 108807587 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-5-oxo-5-phenylpentanamide |
| SMILES | O=C(CCCC(=O)c1ccccc1)Nc1nnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C19H23N3O2S/c23-16(14-8-3-1-4-9-14)12-7-13-17(24)20-19-22-21-18(25-19)15-10-5-2-6-11-15/h1,3-4,8-9,15H,2,5-7,10-13H2,(H,20,22,24) |
| InChIKey | IHRMFSHDAXQOJH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |